Pigment Orange 16 – Corimax Orange BRN
Pigment Orange 16 is a bright, strong orange pigment widely used in coatings, inks, paints, and plastics. Known for its excellent lightfastness, weather resistance, and chemical stability, it delivers vibrant and long-lasting color, making it ideal for both indoor and outdoor applications. This pigment provides good opacity and color strength, ensuring a rich orange hue that maintains its vibrancy over time. Pigment Orange 16 is often chosen for industrial coatings, automotive finishes, and packaging, where durability and color consistency are essential. It is also valued for its non-toxic properties and environmental safety in various manufacturing sectors.
Technical parameters of Pigment orange 16
| Түс индексі №. | Пигмент апельсин 16 |
| Өнім атауы | Corimax Orange BRN |
| Өнім категориясы | Органикалық пигмент |
| CAS нөмірі | 3520-72-7 |
| ЕО нөмірі | 222-530-3 |
| Химиялық отбасы | Disazo |
| Молекулалық салмақ | 623.49 |
| Молекулалық формула | C32H24CI2N8O2 |
| PH мәні | 7 |
| Тығыздық | 1.5 |
| Май сіңіру (мл / 100г)% | 35 |
| Жеңіл жылдамдық (жабу) | 5 |
| Ыстыққа төзімділік (жабу) | 180 |
| Жеңіл жылдамдық (пластик) | 6 |
| Ыстыққа төзімділік (пластик) | 200 |
| Суға төзімділік | 5 |
| Мұнайға төзімділік | 4 |
| Қышқылдыққа төзімділік | 4 |
| Сілтілікке төзімділік | 4 |
Түсі | ![]() |
| Реңктердің таралуы |
Қолдану:
Ұнтақты жабындылар, баспа пасталары, ПВХ, резеңке, PP, PE, офсеттік сиялар, су негізіндегі сиялар, еріткіш сиялар үшін ұсынылады
PS, PU, ультракүлгін сиялар үшін ұсынылған.
Қатысты ақпарат
There are 36 types of pigment commercial dosage forms, and they still have a certain market in Europe, America and Japan. It gives a yellowish orange color, which is significantly redder than the C.I. pigment orange 13 and pigment orange 34. Mainly used in printing inks, and can be used to adjust the color light of C.I. Pigment Yellow 12. Resinized formulations have high transparency, but poor fluidity. Due to their poor fastness properties, they are mostly used for packaging inks with high transparency and low cost.
Лақап аттар: 21160; C.I.Pigment Orange 16; P.O.16; Dianisidine Orange; 2,2'-[[3,3'-dimethyl(1,1'-biphenyl)-4,4'-diyl]bis(azo)]bis(3-oxo-N-phenyl-Butanamide]; 2,2'-[(3,3'-dimethoxybiphenyl-4,4'-diyl)di(E)diazene-2,1-diyl]bis(3-oxo-N-phenylbutanamide)
InChI: InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)/b39-37+,40-38+
Молекулалық құрылым:
Физикалық және химиялық қасиеттері
Solubility: Do not dissolve in water and ethanol, dissolve in concentrated sulfuric acid, and show orange precipitate after dilution.
Hue or light: red light orange
Салыстырмалы тығыздығы: 1.28-1.51
Bulk density / (lb / gal): 10.6-12.5
pH value / (10% slurry): 5.0-7.5
Oil absorption / (g / 100g): 28-54
Қуаты: мөлдір
Structural Identifiers
IUPAC Name: 2,2'-[(3,3'-Dimethoxy[1,1'-biphenyl]-4,4'-diyl)bis(diazene-2,1-diyl)]bis(3-oxo-N-phenylbutanamide)
SMILES: COC1=CC(=CC=C1N=NC(C(C)=O)C(=O)NC1=CC=CC=C1)C1=CC(OC)=C(C=C1)N=NC(C(C)=O)C(=O)NC1=CC=CC=C1
InChI String: InChI=1/C34H32N6O6/c1-21(41)31(33(43)35-25-11-7-5-8-12-25)39-37-27-17-15-23(19-29(27)45-3)24-16-18-28(30(20-24)46-4)38-40-32(22(2)42)34(44)36-26-13-9-6-10-14-26/h5-20,31-32H,1-4H3,(H,35,43)(H,36,44)
InChIKey: DMPXHEMGDYKSFL-UHFFFAOYSA-N
Есептелген қасиеттер
| Меншік атауы | Меншік құны |
| Молекулалық салмақ | 620.7 g/mol |
| XLogP3-AA | 6.7 |
| Сутегі байланысының донорларының саны | 2 |
| Сутегі байланысының акцепторларының саны | 10 |
| Айналмалы облигациялар саны | 13 |
| Нақты масса | 620.23833276 Da |
| Моноизотоптық масса | 620.23833276 Da |
| Топологиялық полярлық бетінің ауданы | 160 Ų |
| Ауыр атомдар саны | 46 |
| Ресми төлем | 0 |
| Күрделілігі | 1000 |
| Изотоп атомдарының саны | 0 |
| Анықталған атом стереоцентрінің саны | 0 |
| Анықталмаған атом стереоцентрінің саны | 2 |
| Анықталған облигация стереоцентрінің саны | 0 |
| Анықталмаған облигация стереоцентрінің саны | 0 |
| Ковалентті байланыс бірліктерінің саны | 1 |
| Құрама канонизацияланған | Иә |











